C15H26O11 — CID 160911140
3,3-diacetyl-4-oxopentanoic acid;(2R,3R,4R,5S)-hexane-1,2,3,4,5,6-hexol (PubChem CID 160911140) has the molecular formula C15H26O11 and a molecular weight of 382.36 g/mol. Its IUPAC name is 3,3-diacetyl-4-oxopentanoic acid;(2R,3R,4R,5S)-hexane-1,2,3,4,5,6-hexol.
| Compound Name | 3,3-diacetyl-4-oxopentanoic acid;(2R,3R,4R,5S)-hexane-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 160911140 |
| Molecular Formula | C15H26O11 |
| Molecular Weight | 382.36 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 3,3-diacetyl-4-oxopentanoic acid;(2R,3R,4R,5S)-hexane-1,2,3,4,5,6-hexol |
| SMILES | CC(=O)C(CC(=O)O)(C(C)=O)C(C)=O.OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C9H12O5.C6H14O6/c1-5(10)9(6(2)11,7(3)12)4-8(13)14;7-1-3(9)5(11)6(12)4(10)2-8/h4H2,1-3H3,(H,13,14);3-12H,1-2H2/t;3-,4+,5-,6-/m.1/s1 |
| InChIKey | SQUIHRBVZAXLII-VCDGYCQFSA-N |
| XLogP | -3.37 |
| TPSA | 209.89 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.36 |
| LogP ≤ 5 | -3.37 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|