C12H20O12 — CID 54495238
2-hydroxy-2-[2-oxo-2-[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexoxy]ethyl]butanedioic acid (PubChem CID 54495238) has the molecular formula C12H20O12 and a molecular weight of 356.28 g/mol. Its IUPAC name is 2-hydroxy-2-[2-oxo-2-[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexoxy]ethyl]butanedioic acid.
| Compound Name | 2-hydroxy-2-[2-oxo-2-[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexoxy]ethyl]butanedioic acid |
|---|---|
| PubChem CID | 54495238 |
| Molecular Formula | C12H20O12 |
| Molecular Weight | 356.28 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | 2-hydroxy-2-[2-oxo-2-[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexoxy]ethyl]butanedioic acid |
| SMILES | O=C(O)CC(O)(CC(=O)OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)C(=O)O |
| InChI | InChI=1S/C12H20O12/c13-3-5(14)9(19)10(20)6(15)4-24-8(18)2-12(23,11(21)22)1-7(16)17/h5-6,9-10,13-15,19-20,23H,1-4H2,(H,16,17)(H,21,22)/t5-,6-,9-,10-,12?/m1/s1 |
| InChIKey | XYPFRPQOTMTBGI-XWKKHKNVSA-N |
| XLogP | -4.35 |
| TPSA | 222.28 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.28 |
| LogP ≤ 5 | -4.35 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |