C12H19NO11 — CID 87290153
2-[2-[(2R,3S,4R,5R)-5-amino-2,3,4-trihydroxy-6-oxohexoxy]-2-oxoethyl]-2-hydroxybutanedioic acid (PubChem CID 87290153) has the molecular formula C12H19NO11 and a molecular weight of 353.28 g/mol. Its IUPAC name is 2-[2-[(2R,3S,4R,5R)-5-amino-2,3,4-trihydroxy-6-oxohexoxy]-2-oxoethyl]-2-hydroxybutanedioic acid.
| Compound Name | 2-[2-[(2R,3S,4R,5R)-5-amino-2,3,4-trihydroxy-6-oxohexoxy]-2-oxoethyl]-2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 87290153 |
| Molecular Formula | C12H19NO11 |
| Molecular Weight | 353.28 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | 2-[2-[(2R,3S,4R,5R)-5-amino-2,3,4-trihydroxy-6-oxohexoxy]-2-oxoethyl]-2-hydroxybutanedioic acid |
| SMILES | N[C@@H](C=O)[C@@H](O)[C@H](O)[C@H](O)COC(=O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C12H19NO11/c13-5(3-14)9(19)10(20)6(15)4-24-8(18)2-12(23,11(21)22)1-7(16)17/h3,5-6,9-10,15,19-20,23H,1-2,4,13H2,(H,16,17)(H,21,22)/t5-,6+,9+,10+,12?/m0/s1 |
| InChIKey | DWEHXKGDFMTCLK-ITQLTOJHSA-N |
| XLogP | -4.18 |
| TPSA | 224.91 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.28 |
| LogP ≤ 5 | -4.18 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|