C12H18O12 — CID 22855900
2-hydroxy-2-[2-oxo-2-[(2R,3S,4R,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]oxyethyl]butanedioic acid (PubChem CID 22855900) has the molecular formula C12H18O12 and a molecular weight of 354.26 g/mol. Its IUPAC name is 2-hydroxy-2-[2-oxo-2-[(2R,3S,4R,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]oxyethyl]butanedioic acid.
| Compound Name | 2-hydroxy-2-[2-oxo-2-[(2R,3S,4R,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]oxyethyl]butanedioic acid |
|---|---|
| PubChem CID | 22855900 |
| Molecular Formula | C12H18O12 |
| Molecular Weight | 354.26 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | 2-hydroxy-2-[2-oxo-2-[(2R,3S,4R,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]oxyethyl]butanedioic acid |
| SMILES | O=C[C@H](OC(=O)CC(O)(CC(=O)O)C(=O)O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C12H18O12/c13-3-5(15)9(19)10(20)6(4-14)24-8(18)2-12(23,11(21)22)1-7(16)17/h4-6,9-10,13,15,19-20,23H,1-3H2,(H,16,17)(H,21,22)/t5-,6+,9-,10-,12?/m1/s1 |
| InChIKey | IYWFBVGSUGKYME-OGBBFBBLSA-N |
| XLogP | -4.15 |
| TPSA | 219.12 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.26 |
| LogP ≤ 5 | -4.15 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|