C16H26N2O13 — CID 18390944
2-[carboxymethyl-[2-[carboxymethyl-[2-oxo-2-[(2R,3S,4R,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]oxyethyl]amino]ethyl]amino]acetic acid (PubChem CID 18390944) has the molecular formula C16H26N2O13 and a molecular weight of 454.39 g/mol. Its IUPAC name is 2-[carboxymethyl-[2-[carboxymethyl-[2-oxo-2-[(2R,3S,4R,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]oxyethyl]amino]ethyl]amino]acetic acid.
| Compound Name | 2-[carboxymethyl-[2-[carboxymethyl-[2-oxo-2-[(2R,3S,4R,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]oxyethyl]amino]ethyl]amino]acetic acid |
|---|---|
| PubChem CID | 18390944 |
| Molecular Formula | C16H26N2O13 |
| Molecular Weight | 454.39 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | 2-[carboxymethyl-[2-[carboxymethyl-[2-oxo-2-[(2R,3S,4R,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]oxyethyl]amino]ethyl]amino]acetic acid |
| SMILES | O=C[C@H](OC(=O)CN(CCN(CC(=O)O)CC(=O)O)CC(=O)O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C16H26N2O13/c19-7-9(21)15(29)16(30)10(8-20)31-14(28)6-18(5-13(26)27)2-1-17(3-11(22)23)4-12(24)25/h8-10,15-16,19,21,29-30H,1-7H2,(H,22,23)(H,24,25)(H,26,27)/t9-,10+,15-,16-/m1/s1 |
| InChIKey | BAJBIEKJUUXPAY-GYHMKYFYSA-N |
| XLogP | -4.97 |
| TPSA | 242.67 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.39 |
| LogP ≤ 5 | -4.97 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|