C10H16O12S — CID 121378712
4-oxo-2-sulfo-4-[(2R,3S,4R,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]oxybutanoic acid (PubChem CID 121378712) has the molecular formula C10H16O12S and a molecular weight of 360.29 g/mol. Its IUPAC name is 4-oxo-2-sulfo-4-[(2R,3S,4R,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]oxybutanoic acid.
| Compound Name | 4-oxo-2-sulfo-4-[(2R,3S,4R,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]oxybutanoic acid |
|---|---|
| PubChem CID | 121378712 |
| Molecular Formula | C10H16O12S |
| Molecular Weight | 360.29 g/mol |
| Exact Mass | 360.04 |
| IUPAC Name | 4-oxo-2-sulfo-4-[(2R,3S,4R,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]oxybutanoic acid |
| SMILES | O=C[C@H](OC(=O)CC(C(=O)O)S(=O)(=O)O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C10H16O12S/c11-2-4(13)8(15)9(16)5(3-12)22-7(14)1-6(10(17)18)23(19,20)21/h3-6,8-9,11,13,15-16H,1-2H2,(H,17,18)(H,19,20,21)/t4-,5+,6?,8-,9-/m1/s1 |
| InChIKey | OUOZSZADQYHFTN-TZFKILSRSA-N |
| XLogP | -4.10 |
| TPSA | 215.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.29 |
| LogP ≤ 5 | -4.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|