C6H14O10S — CID 89183763
[(2R,3S,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl] hydrogen sulfate;hydrate (PubChem CID 89183763) has the molecular formula C6H14O10S and a molecular weight of 278.24 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl] hydrogen sulfate;hydrate.
| Compound Name | [(2R,3S,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl] hydrogen sulfate;hydrate |
|---|---|
| PubChem CID | 89183763 |
| Molecular Formula | C6H14O10S |
| Molecular Weight | 278.24 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | [(2R,3S,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl] hydrogen sulfate;hydrate |
| SMILES | O.O=C[C@H](OS(=O)(=O)O)[C@@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H12O9S.H2O/c7-1-3(9)5(10)6(11)4(2-8)15-16(12,13)14;/h2-7,9-11H,1H2,(H,12,13,14);1H2/t3-,4+,5+,6-;/m1./s1 |
| InChIKey | AQDDYJUIWPFJJW-OLALXQGDSA-N |
| XLogP | -4.38 |
| TPSA | 193.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.24 |
| LogP ≤ 5 | -4.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|