[(2R,3R,4R)-3,4,5-trihydroxy-1-oxopentan-2-yl] hydrogen sulfate

C5H10O8S — CID 87142592

IUPAC[(2R,3R,4R)-3,4,5-trihydroxy-1-oxopentan-2-yl] hydrogen sulfate
SMILESO=C[C@H](OS(=O)(=O)O)[C@H](O)[C@H](O)CO
InChIInChI=1S/C5H10O8S/c6-1-3(8)5(9)4(2-7)13-14(10,11)12/h2-6,8-9H,1H2,(H,10,11,12)/t3-,4+,5-/m1/s1
InChIKeyFLWSGDLRFPYUMF-MROZADKFSA-N
MW230.19 g/mol
LogP-2.91
Rot. Bonds6

About [(2R,3R,4R)-3,4,5-trihydroxy-1-oxopentan-2-yl] hydrogen sulfate

[(2R,3R,4R)-3,4,5-trihydroxy-1-oxopentan-2-yl] hydrogen sulfate (PubChem CID 87142592) has the molecular formula C5H10O8S and a molecular weight of 230.19 g/mol. Its IUPAC name is [(2R,3R,4R)-3,4,5-trihydroxy-1-oxopentan-2-yl] hydrogen sulfate.

Molecular Properties

Compound Name[(2R,3R,4R)-3,4,5-trihydroxy-1-oxopentan-2-yl] hydrogen sulfate
PubChem CID87142592
Molecular FormulaC5H10O8S
Molecular Weight230.19 g/mol
Exact Mass230.01
IUPAC Name[(2R,3R,4R)-3,4,5-trihydroxy-1-oxopentan-2-yl] hydrogen sulfate
SMILESO=C[C@H](OS(=O)(=O)O)[C@H](O)[C@H](O)CO
InChIInChI=1S/C5H10O8S/c6-1-3(8)5(9)4(2-7)13-14(10,11)12/h2-6,8-9H,1H2,(H,10,11,12)/t3-,4+,5-/m1/s1
InChIKeyFLWSGDLRFPYUMF-MROZADKFSA-N
XLogP-2.91
TPSA141.36 Ų
H-Bond Donors4
H-Bond Acceptors7
Rotatable Bonds6
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500230.19
LogP ≤ 5-2.91
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 107

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze [(2R,3R,4R)-3,4,5-trihydroxy-1-oxopentan-2-yl] hydrogen sulfate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [(2R,3R,4R)-3,4,5-trihydroxy-1-oxopentan-2-yl] hydrogen sulfate?
The IUPAC name of [(2R,3R,4R)-3,4,5-trihydroxy-1-oxopentan-2-yl] hydrogen sulfate (CID 87142592) is [(2R,3R,4R)-3,4,5-trihydroxy-1-oxopentan-2-yl] hydrogen sulfate.
What is the SMILES notation for [(2R,3R,4R)-3,4,5-trihydroxy-1-oxopentan-2-yl] hydrogen sulfate?
The canonical SMILES for [(2R,3R,4R)-3,4,5-trihydroxy-1-oxopentan-2-yl] hydrogen sulfate is O=C[C@H](OS(=O)(=O)O)[C@H](O)[C@H](O)CO.
What is the InChIKey of [(2R,3R,4R)-3,4,5-trihydroxy-1-oxopentan-2-yl] hydrogen sulfate?
The InChIKey is FLWSGDLRFPYUMF-MROZADKFSA-N. The full InChI is InChI=1S/C5H10O8S/c6-1-3(8)5(9)4(2-7)13-14(10,11)12/h2-6,8-9H,1H2,(H,10,11,12)/t3-,4+,5-/m1/s1.
What are the key properties of [(2R,3R,4R)-3,4,5-trihydroxy-1-oxopentan-2-yl] hydrogen sulfate?
[(2R,3R,4R)-3,4,5-trihydroxy-1-oxopentan-2-yl] hydrogen sulfate has a molecular weight of 230.19 g/mol, XLogP of -2.91, 6 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,3R,4R)-3,4,5-trihydroxy-1-oxopentan-2-yl] hydrogen sulfate is sourced from PubChem (CID 87142592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).