C5H10O8S — CID 87521956
[(2S,3S,4R)-3,4,5-trihydroxy-1-oxopentan-2-yl] hydrogen sulfate (PubChem CID 87521956) has the molecular formula C5H10O8S and a molecular weight of 230.19 g/mol. Its IUPAC name is [(2S,3S,4R)-3,4,5-trihydroxy-1-oxopentan-2-yl] hydrogen sulfate.
| Compound Name | [(2S,3S,4R)-3,4,5-trihydroxy-1-oxopentan-2-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 87521956 |
| Molecular Formula | C5H10O8S |
| Molecular Weight | 230.19 g/mol |
| Exact Mass | 230.01 |
| IUPAC Name | [(2S,3S,4R)-3,4,5-trihydroxy-1-oxopentan-2-yl] hydrogen sulfate |
| SMILES | O=C[C@@H](OS(=O)(=O)O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C5H10O8S/c6-1-3(8)5(9)4(2-7)13-14(10,11)12/h2-6,8-9H,1H2,(H,10,11,12)/t3-,4-,5+/m1/s1 |
| InChIKey | FLWSGDLRFPYUMF-WDCZJNDASA-N |
| XLogP | -2.91 |
| TPSA | 141.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.19 |
| LogP ≤ 5 | -2.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|