C12H28N2O14S — CID 73415774
bis((2R,3R,4S,5R)-2-amino-3,4,5,6-tetrahydroxyhexanal);sulfuric acid (PubChem CID 73415774) has the molecular formula C12H28N2O14S and a molecular weight of 456.42 g/mol. Its IUPAC name is bis((2R,3R,4S,5R)-2-amino-3,4,5,6-tetrahydroxyhexanal);sulfuric acid.
| Compound Name | bis((2R,3R,4S,5R)-2-amino-3,4,5,6-tetrahydroxyhexanal);sulfuric acid |
|---|---|
| PubChem CID | 73415774 |
| Molecular Formula | C12H28N2O14S |
| Molecular Weight | 456.42 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | bis((2R,3R,4S,5R)-2-amino-3,4,5,6-tetrahydroxyhexanal);sulfuric acid |
| SMILES | N[C@@H](C=O)[C@@H](O)[C@H](O)[C@H](O)CO.N[C@@H](C=O)[C@@H](O)[C@H](O)[C@H](O)CO.O=S(=O)(O)O |
| InChI | InChI=1S/2C6H13NO5.H2O4S/c2*7-3(1-8)5(11)6(12)4(10)2-9;1-5(2,3)4/h2*1,3-6,9-12H,2,7H2;(H2,1,2,3,4)/t2*3-,4+,5+,6+;/m00./s1 |
| InChIKey | WLNBMPZUVDTASE-HXIISURNSA-N |
| XLogP | -7.48 |
| TPSA | 322.62 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.42 |
| LogP ≤ 5 | -7.48 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|