C6H15N3O4 — CID 86740780
(2R,3S,4R,5S)-5-amino-6-hydrazinylidenehexane-1,2,3,4-tetrol (PubChem CID 86740780) has the molecular formula C6H15N3O4 and a molecular weight of 193.20 g/mol. Its IUPAC name is (2R,3S,4R,5S)-5-amino-6-hydrazinylidenehexane-1,2,3,4-tetrol.
| Compound Name | (2R,3S,4R,5S)-5-amino-6-hydrazinylidenehexane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 86740780 |
| Molecular Formula | C6H15N3O4 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | (2R,3S,4R,5S)-5-amino-6-hydrazinylidenehexane-1,2,3,4-tetrol |
| SMILES | NN=C[C@H](N)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H15N3O4/c7-3(1-9-8)5(12)6(13)4(11)2-10/h1,3-6,10-13H,2,7-8H2/t3-,4+,5+,6+/m0/s1 |
| InChIKey | SNUXGKIHLBLRSZ-SLPGGIOYSA-N |
| XLogP | -3.67 |
| TPSA | 145.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | -3.67 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|