C6H15ClN2O5Pt — CID 88689759
(2R,3S,4R,5S,6E)-6-hydrazinylidenehexane-1,2,3,4,5-pentol;platinum;hydrochloride (PubChem CID 88689759) has the molecular formula C6H15ClN2O5Pt and a molecular weight of 425.73 g/mol. Its IUPAC name is (2R,3S,4R,5S,6E)-6-hydrazinylidenehexane-1,2,3,4,5-pentol;platinum;hydrochloride.
| Compound Name | (2R,3S,4R,5S,6E)-6-hydrazinylidenehexane-1,2,3,4,5-pentol;platinum;hydrochloride |
|---|---|
| PubChem CID | 88689759 |
| Molecular Formula | C6H15ClN2O5Pt |
| Molecular Weight | 425.73 g/mol |
| Exact Mass | 425.03 |
| IUPAC Name | (2R,3S,4R,5S,6E)-6-hydrazinylidenehexane-1,2,3,4,5-pentol;platinum;hydrochloride |
| SMILES | Cl.N/N=C/[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)CO.[Pt] |
| InChI | InChI=1S/C6H14N2O5.ClH.Pt/c7-8-1-3(10)5(12)6(13)4(11)2-9;;/h1,3-6,9-13H,2,7H2;1H;/b8-1+;;/t3-,4+,5+,6-;;/m0../s1 |
| InChIKey | WSZKEYKRFFNTGH-HTUPRGFYSA-N |
| XLogP | -3.21 |
| TPSA | 139.53 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.73 |
| LogP ≤ 5 | -3.21 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|