C5H11NO5 — CID 21159531
(2S,3R,4S,5E)-5-hydroxyiminopentane-1,2,3,4-tetrol (PubChem CID 21159531) has the molecular formula C5H11NO5 and a molecular weight of 165.14 g/mol. Its IUPAC name is (2S,3R,4S,5E)-5-hydroxyiminopentane-1,2,3,4-tetrol.
| Compound Name | (2S,3R,4S,5E)-5-hydroxyiminopentane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 21159531 |
| Molecular Formula | C5H11NO5 |
| Molecular Weight | 165.14 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | (2S,3R,4S,5E)-5-hydroxyiminopentane-1,2,3,4-tetrol |
| SMILES | OC[C@H](O)[C@H](O)[C@@H](O)/C=N/O |
| InChI | InChI=1S/C5H11NO5/c7-2-4(9)5(10)3(8)1-6-11/h1,3-5,7-11H,2H2/b6-1+/t3-,4-,5+/m0/s1 |
| InChIKey | OKDOWAAKOUUJPX-QXFJXBHLSA-N |
| XLogP | -2.48 |
| TPSA | 113.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.14 |
| LogP ≤ 5 | -2.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|