C5H10O4S — CID 18533987
2,3,4,5-tetrahydroxypentanethial (PubChem CID 18533987) has the molecular formula C5H10O4S and a molecular weight of 166.20 g/mol. Its IUPAC name is 2,3,4,5-tetrahydroxypentanethial.
| Compound Name | 2,3,4,5-tetrahydroxypentanethial |
|---|---|
| PubChem CID | 18533987 |
| Molecular Formula | C5H10O4S |
| Molecular Weight | 166.20 g/mol |
| Exact Mass | 166.03 |
| IUPAC Name | 2,3,4,5-tetrahydroxypentanethial |
| SMILES | OCC(O)C(O)C(O)C=S |
| InChI | InChI=1S/C5H10O4S/c6-1-3(7)5(9)4(8)2-10/h2-9H,1H2 |
| InChIKey | KDKMTIRSYIHSTB-UHFFFAOYSA-N |
| XLogP | -1.94 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.20 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|