C6H12AuO5S — CID 87532917
gold;(2S,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanethial (PubChem CID 87532917) has the molecular formula C6H12AuO5S and a molecular weight of 393.19 g/mol. Its IUPAC name is gold;(2S,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanethial.
| Compound Name | gold;(2S,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanethial |
|---|---|
| PubChem CID | 87532917 |
| Molecular Formula | C6H12AuO5S |
| Molecular Weight | 393.19 g/mol |
| Exact Mass | 393.01 |
| IUPAC Name | gold;(2S,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanethial |
| SMILES | OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)C=S.[Au] |
| InChI | InChI=1S/C6H12O5S.Au/c7-1-3(8)5(10)6(11)4(9)2-12;/h2-11H,1H2;/t3-,4-,5-,6-;/m1./s1 |
| InChIKey | MBUPOSHTJMTLLW-MVNLRXSJSA-N |
| XLogP | -2.58 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.19 |
| LogP ≤ 5 | -2.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|