C6H11FO3S — CID 88665279
(2R,3R,4R)-6-fluoro-2,3,4-trihydroxyhexanethial (PubChem CID 88665279) has the molecular formula C6H11FO3S and a molecular weight of 182.22 g/mol. Its IUPAC name is (2R,3R,4R)-6-fluoro-2,3,4-trihydroxyhexanethial.
| Compound Name | (2R,3R,4R)-6-fluoro-2,3,4-trihydroxyhexanethial |
|---|---|
| PubChem CID | 88665279 |
| Molecular Formula | C6H11FO3S |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.04 |
| IUPAC Name | (2R,3R,4R)-6-fluoro-2,3,4-trihydroxyhexanethial |
| SMILES | O[C@H]([C@H](O)CCF)[C@@H](O)C=S |
| InChI | InChI=1S/C6H11FO3S/c7-2-1-4(8)6(10)5(9)3-11/h3-6,8-10H,1-2H2/t4-,5+,6-/m1/s1 |
| InChIKey | ZZVBPPWKALVLSW-NGJCXOISSA-N |
| XLogP | -0.57 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|