C7H14O6 — CID 87503461
(2S,3R,4S,5R)-2,3,4,5,7-pentahydroxyheptanal (PubChem CID 87503461) has the molecular formula C7H14O6 and a molecular weight of 194.18 g/mol. Its IUPAC name is (2S,3R,4S,5R)-2,3,4,5,7-pentahydroxyheptanal.
| Compound Name | (2S,3R,4S,5R)-2,3,4,5,7-pentahydroxyheptanal |
|---|---|
| PubChem CID | 87503461 |
| Molecular Formula | C7H14O6 |
| Molecular Weight | 194.18 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | (2S,3R,4S,5R)-2,3,4,5,7-pentahydroxyheptanal |
| SMILES | O=C[C@@H](O)[C@H](O)[C@@H](O)[C@H](O)CCO |
| InChI | InChI=1S/C7H14O6/c8-2-1-4(10)6(12)7(13)5(11)3-9/h3-8,10-13H,1-2H2/t4-,5-,6+,7+/m1/s1 |
| InChIKey | YTDXCLRWYXTNRN-JWXFUTCRSA-N |
| XLogP | -2.99 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.18 |
| LogP ≤ 5 | -2.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|