C6H13NO3 — CID 75252970
1-aminohex-5-ene-2,3,4-triol (PubChem CID 75252970) has the molecular formula C6H13NO3 and a molecular weight of 147.17 g/mol. Its IUPAC name is 1-aminohex-5-ene-2,3,4-triol.
| Compound Name | 1-aminohex-5-ene-2,3,4-triol |
|---|---|
| PubChem CID | 75252970 |
| Molecular Formula | C6H13NO3 |
| Molecular Weight | 147.17 g/mol |
| Exact Mass | 147.09 |
| IUPAC Name | 1-aminohex-5-ene-2,3,4-triol |
| SMILES | C=CC(O)C(O)C(O)CN |
| InChI | InChI=1S/C6H13NO3/c1-2-4(8)6(10)5(9)3-7/h2,4-6,8-10H,1,3,7H2 |
| InChIKey | PEKDXFIRUCNGGW-UHFFFAOYSA-N |
| XLogP | -1.79 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.17 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|