C6H10O2 — CID 15562511
(4S)-hexa-1,5-diene-3,4-diol (PubChem CID 15562511) has the molecular formula C6H10O2 and a molecular weight of 114.14 g/mol. Its IUPAC name is (4S)-hexa-1,5-diene-3,4-diol.
| Compound Name | (4S)-hexa-1,5-diene-3,4-diol |
|---|---|
| PubChem CID | 15562511 |
| Molecular Formula | C6H10O2 |
| Molecular Weight | 114.14 g/mol |
| Exact Mass | 114.07 |
| IUPAC Name | (4S)-hexa-1,5-diene-3,4-diol |
| SMILES | C=CC(O)[C@@H](O)C=C |
| InChI | InChI=1S/C6H10O2/c1-3-5(7)6(8)4-2/h3-8H,1-2H2/t5-,6?/m0/s1 |
| InChIKey | KUQWZSZYIQGTHT-ZBHICJROSA-N |
| XLogP | 0.08 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.14 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|