C7H12O2 — CID 131234166
(3S,4R,5E)-hepta-1,5-diene-3,4-diol (PubChem CID 131234166) has the molecular formula C7H12O2 and a molecular weight of 128.17 g/mol. Its IUPAC name is (3S,4R,5E)-hepta-1,5-diene-3,4-diol.
| Compound Name | (3S,4R,5E)-hepta-1,5-diene-3,4-diol |
|---|---|
| PubChem CID | 131234166 |
| Molecular Formula | C7H12O2 |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.08 |
| IUPAC Name | (3S,4R,5E)-hepta-1,5-diene-3,4-diol |
| SMILES | C=C[C@H](O)[C@H](O)/C=C/C |
| InChI | InChI=1S/C7H12O2/c1-3-5-7(9)6(8)4-2/h3-9H,2H2,1H3/b5-3+/t6-,7+/m0/s1 |
| InChIKey | ADXMFHMYYFZEGM-FXWAVASWSA-N |
| XLogP | 0.47 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|