C6H10OS2 — CID 154327842
hexa-1,4-dien-3-yl-hydroxy-sulfanylidene-λ4-sulfane (PubChem CID 154327842) has the molecular formula C6H10OS2 and a molecular weight of 162.28 g/mol. Its IUPAC name is hexa-1,4-dien-3-yl-hydroxy-sulfanylidene-λ4-sulfane.
| Compound Name | hexa-1,4-dien-3-yl-hydroxy-sulfanylidene-λ4-sulfane |
|---|---|
| PubChem CID | 154327842 |
| Molecular Formula | C6H10OS2 |
| Molecular Weight | 162.28 g/mol |
| Exact Mass | 162.02 |
| IUPAC Name | hexa-1,4-dien-3-yl-hydroxy-sulfanylidene-λ4-sulfane |
| SMILES | C=CC(C=CC)S(O)=S |
| InChI | InChI=1S/C6H10OS2/c1-3-5-6(4-2)9(7)8/h3-6H,2H2,1H3,(H,7,8) |
| InChIKey | HEGKUUKNLLCDMZ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.28 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|