C8H14O — CID 158634176
(2Z,5E)-4-methylhepta-2,5-dien-2-ol (PubChem CID 158634176) has the molecular formula C8H14O and a molecular weight of 126.20 g/mol. Its IUPAC name is (2Z,5E)-4-methylhepta-2,5-dien-2-ol.
| Compound Name | (2Z,5E)-4-methylhepta-2,5-dien-2-ol |
|---|---|
| PubChem CID | 158634176 |
| Molecular Formula | C8H14O |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.10 |
| IUPAC Name | (2Z,5E)-4-methylhepta-2,5-dien-2-ol |
| SMILES | C/C=C/C(C)/C=C(/C)O |
| InChI | InChI=1S/C8H14O/c1-4-5-7(2)6-8(3)9/h4-7,9H,1-3H3/b5-4+,8-6- |
| InChIKey | PUYAKHAGDFYEMK-LMJRQTCTSA-N |
| XLogP | 2.66 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|