C12H20O — CID 102272672
(2E,5E,7S,8E)-5,7-dimethyldeca-2,5,8-trien-1-ol (PubChem CID 102272672) has the molecular formula C12H20O and a molecular weight of 180.29 g/mol. Its IUPAC name is (2E,5E,7S,8E)-5,7-dimethyldeca-2,5,8-trien-1-ol.
| Compound Name | (2E,5E,7S,8E)-5,7-dimethyldeca-2,5,8-trien-1-ol |
|---|---|
| PubChem CID | 102272672 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | (2E,5E,7S,8E)-5,7-dimethyldeca-2,5,8-trien-1-ol |
| SMILES | C/C=C/[C@H](C)/C=C(\C)C/C=C/CO |
| InChI | InChI=1S/C12H20O/c1-4-7-11(2)10-12(3)8-5-6-9-13/h4-7,10-11,13H,8-9H2,1-3H3/b6-5+,7-4+,12-10+/t11-/m0/s1 |
| InChIKey | INCBPMMVCLERAW-ZUEIOARFSA-N |
| XLogP | 3.08 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|