C6H10Cl2O — CID 25187324
(E,4S,5R)-4,5-dichlorohex-2-en-1-ol (PubChem CID 25187324) has the molecular formula C6H10Cl2O and a molecular weight of 169.05 g/mol. Its IUPAC name is (E,4S,5R)-4,5-dichlorohex-2-en-1-ol.
| Compound Name | (E,4S,5R)-4,5-dichlorohex-2-en-1-ol |
|---|---|
| PubChem CID | 25187324 |
| Molecular Formula | C6H10Cl2O |
| Molecular Weight | 169.05 g/mol |
| Exact Mass | 168.01 |
| IUPAC Name | (E,4S,5R)-4,5-dichlorohex-2-en-1-ol |
| SMILES | C[C@@H](Cl)[C@@H](Cl)/C=C/CO |
| InChI | InChI=1S/C6H10Cl2O/c1-5(7)6(8)3-2-4-9/h2-3,5-6,9H,4H2,1H3/b3-2+/t5-,6+/m1/s1 |
| InChIKey | GLRPQACQBUATFM-QQTLEDFYSA-N |
| XLogP | 1.77 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.05 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|