C6H12O2 — CID 78100137
4-methylpent-2-ene-1,5-diol (PubChem CID 78100137) has the molecular formula C6H12O2 and a molecular weight of 116.16 g/mol. Its IUPAC name is 4-methylpent-2-ene-1,5-diol.
| Compound Name | 4-methylpent-2-ene-1,5-diol |
|---|---|
| PubChem CID | 78100137 |
| Molecular Formula | C6H12O2 |
| Molecular Weight | 116.16 g/mol |
| Exact Mass | 116.08 |
| IUPAC Name | 4-methylpent-2-ene-1,5-diol |
| SMILES | CC(C=CCO)CO |
| InChI | InChI=1S/C6H12O2/c1-6(5-8)3-2-4-7/h2-3,6-8H,4-5H2,1H3 |
| InChIKey | QLZWQRFAAFMCBT-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 116.16 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|