C19H36O — CID 5364412
(3Z,13Z)-2-methyloctadeca-3,13-dien-1-ol (PubChem CID 5364412) has the molecular formula C19H36O and a molecular weight of 280.50 g/mol. Its IUPAC name is (3Z,13Z)-2-methyloctadeca-3,13-dien-1-ol.
| Compound Name | (3Z,13Z)-2-methyloctadeca-3,13-dien-1-ol |
|---|---|
| PubChem CID | 5364412 |
| Molecular Formula | C19H36O |
| Molecular Weight | 280.50 g/mol |
| Exact Mass | 280.28 |
| IUPAC Name | (3Z,13Z)-2-methyloctadeca-3,13-dien-1-ol |
| SMILES | CCCC/C=C\CCCCCCCC/C=C\C(C)CO |
| InChI | InChI=1S/C19H36O/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19(2)18-20/h6-7,16-17,19-20H,3-5,8-15,18H2,1-2H3/b7-6-,17-16- |
| InChIKey | ZIOOKYHAOBSYOH-DNNFRFAMSA-N |
| XLogP | 6.04 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.50 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|