C11H22O2 — CID 87273368
(E)-5-methoxy-4,7-dimethyloct-2-en-1-ol (PubChem CID 87273368) has the molecular formula C11H22O2 and a molecular weight of 186.29 g/mol. Its IUPAC name is (E)-5-methoxy-4,7-dimethyloct-2-en-1-ol.
| Compound Name | (E)-5-methoxy-4,7-dimethyloct-2-en-1-ol |
|---|---|
| PubChem CID | 87273368 |
| Molecular Formula | C11H22O2 |
| Molecular Weight | 186.29 g/mol |
| Exact Mass | 186.16 |
| IUPAC Name | (E)-5-methoxy-4,7-dimethyloct-2-en-1-ol |
| SMILES | COC(CC(C)C)C(C)/C=C/CO |
| InChI | InChI=1S/C11H22O2/c1-9(2)8-11(13-4)10(3)6-5-7-12/h5-6,9-12H,7-8H2,1-4H3/b6-5+ |
| InChIKey | QAEGHUNERQWYRD-AATRIKPKSA-N |
| XLogP | 2.23 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.29 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|