C10H17F — CID 143508838
(2Z,5Z)-8-fluoro-5,7-dimethylocta-2,5-diene (PubChem CID 143508838) has the molecular formula C10H17F and a molecular weight of 156.24 g/mol. Its IUPAC name is (2Z,5Z)-8-fluoro-5,7-dimethylocta-2,5-diene.
| Compound Name | (2Z,5Z)-8-fluoro-5,7-dimethylocta-2,5-diene |
|---|---|
| PubChem CID | 143508838 |
| Molecular Formula | C10H17F |
| Molecular Weight | 156.24 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | (2Z,5Z)-8-fluoro-5,7-dimethylocta-2,5-diene |
| SMILES | C/C=C\C/C(C)=C\C(C)CF |
| InChI | InChI=1S/C10H17F/c1-4-5-6-9(2)7-10(3)8-11/h4-5,7,10H,6,8H2,1-3H3/b5-4-,9-7- |
| InChIKey | IFAZGORXBHHKSX-PHSHQRSZSA-N |
| XLogP | 3.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.24 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|