C9H17F — CID 155390379
1-fluoro-2,4-dimethylhept-3-ene (PubChem CID 155390379) has the molecular formula C9H17F and a molecular weight of 144.23 g/mol. Its IUPAC name is 1-fluoro-2,4-dimethylhept-3-ene.
| Compound Name | 1-fluoro-2,4-dimethylhept-3-ene |
|---|---|
| PubChem CID | 155390379 |
| Molecular Formula | C9H17F |
| Molecular Weight | 144.23 g/mol |
| Exact Mass | 144.13 |
| IUPAC Name | 1-fluoro-2,4-dimethylhept-3-ene |
| SMILES | CCCC(C)=CC(C)CF |
| InChI | InChI=1S/C9H17F/c1-4-5-8(2)6-9(3)7-10/h6,9H,4-5,7H2,1-3H3 |
| InChIKey | FMDIBJAFHNKFLH-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.23 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|