C9H18 — CID 25021557
(E,5S)-3,5-dimethylhept-3-ene (PubChem CID 25021557) has the molecular formula C9H18 and a molecular weight of 126.24 g/mol. Its IUPAC name is (E,5S)-3,5-dimethylhept-3-ene.
| Compound Name | (E,5S)-3,5-dimethylhept-3-ene |
|---|---|
| PubChem CID | 25021557 |
| Molecular Formula | C9H18 |
| Molecular Weight | 126.24 g/mol |
| Exact Mass | 126.14 |
| IUPAC Name | (E,5S)-3,5-dimethylhept-3-ene |
| SMILES | CC/C(C)=C/[C@@H](C)CC |
| InChI | InChI=1S/C9H18/c1-5-8(3)7-9(4)6-2/h7-8H,5-6H2,1-4H3/b9-7+/t8-/m0/s1 |
| InChIKey | OXOLZWHOQAEIAW-INTFFVIUSA-N |
| XLogP | 3.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.24 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|