C8H16 — CID 142611901
(4R)-2,4-dimethylhex-2-ene (PubChem CID 142611901) has the molecular formula C8H16 and a molecular weight of 112.22 g/mol. Its IUPAC name is (4R)-2,4-dimethylhex-2-ene.
| Compound Name | (4R)-2,4-dimethylhex-2-ene |
|---|---|
| PubChem CID | 142611901 |
| Molecular Formula | C8H16 |
| Molecular Weight | 112.22 g/mol |
| Exact Mass | 112.13 |
| IUPAC Name | (4R)-2,4-dimethylhex-2-ene |
| SMILES | CC[C@@H](C)C=C(C)C |
| InChI | InChI=1S/C8H16/c1-5-8(4)6-7(2)3/h6,8H,5H2,1-4H3/t8-/m1/s1 |
| InChIKey | IZSBIPQYBGDXJZ-MRVPVSSYSA-N |
| XLogP | 3.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.22 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|