C10H19Cl — CID 115278020
3-(chloromethyl)-2,5-dimethylhept-3-ene (PubChem CID 115278020) has the molecular formula C10H19Cl and a molecular weight of 174.71 g/mol. Its IUPAC name is 3-(chloromethyl)-2,5-dimethylhept-3-ene.
| Compound Name | 3-(chloromethyl)-2,5-dimethylhept-3-ene |
|---|---|
| PubChem CID | 115278020 |
| Molecular Formula | C10H19Cl |
| Molecular Weight | 174.71 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 3-(chloromethyl)-2,5-dimethylhept-3-ene |
| SMILES | CCC(C)C=C(CCl)C(C)C |
| InChI | InChI=1S/C10H19Cl/c1-5-9(4)6-10(7-11)8(2)3/h6,8-9H,5,7H2,1-4H3 |
| InChIKey | NZQBTQPDVBRPBS-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.71 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|