C11H21N — CID 166865760
(2Z)-N,4,6-trimethylocta-2,4-dien-3-amine (PubChem CID 166865760) has the molecular formula C11H21N and a molecular weight of 167.30 g/mol. Its IUPAC name is (2Z)-N,4,6-trimethylocta-2,4-dien-3-amine.
| Compound Name | (2Z)-N,4,6-trimethylocta-2,4-dien-3-amine |
|---|---|
| PubChem CID | 166865760 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | (2Z)-N,4,6-trimethylocta-2,4-dien-3-amine |
| SMILES | C/C=C(\NC)C(C)=CC(C)CC |
| InChI | InChI=1S/C11H21N/c1-6-9(3)8-10(4)11(7-2)12-5/h7-9,12H,6H2,1-5H3/b10-8?,11-7- |
| InChIKey | ZWIOWPPLRVITMQ-UUGCJLSRSA-N |
| XLogP | 3.10 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|