C11H20O — CID 101448778
(2E,4Z)-2,4,6-trimethylocta-2,4-dien-1-ol (PubChem CID 101448778) has the molecular formula C11H20O and a molecular weight of 168.28 g/mol. Its IUPAC name is (2E,4Z)-2,4,6-trimethylocta-2,4-dien-1-ol.
| Compound Name | (2E,4Z)-2,4,6-trimethylocta-2,4-dien-1-ol |
|---|---|
| PubChem CID | 101448778 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | (2E,4Z)-2,4,6-trimethylocta-2,4-dien-1-ol |
| SMILES | CCC(C)/C=C(C)\C=C(/C)CO |
| InChI | InChI=1S/C11H20O/c1-5-9(2)6-10(3)7-11(4)8-12/h6-7,9,12H,5,8H2,1-4H3/b10-6-,11-7+ |
| InChIKey | TVFZGOGNJSRZGO-NAKBGQTNSA-N |
| XLogP | 2.92 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|