C15H24O5S — CID 72707212
(2E,4E,6E,8E)-8,10-dimethyldodeca-2,4,6,8-tetraenoic acid;methanesulfonic acid (PubChem CID 72707212) has the molecular formula C15H24O5S and a molecular weight of 316.42 g/mol. Its IUPAC name is (2E,4E,6E,8E)-8,10-dimethyldodeca-2,4,6,8-tetraenoic acid;methanesulfonic acid.
| Compound Name | (2E,4E,6E,8E)-8,10-dimethyldodeca-2,4,6,8-tetraenoic acid;methanesulfonic acid |
|---|---|
| PubChem CID | 72707212 |
| Molecular Formula | C15H24O5S |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | (2E,4E,6E,8E)-8,10-dimethyldodeca-2,4,6,8-tetraenoic acid;methanesulfonic acid |
| SMILES | CCC(C)/C=C(C)/C=C/C=C/C=C/C(=O)O.CS(=O)(=O)O |
| InChI | InChI=1S/C14H20O2.CH4O3S/c1-4-12(2)11-13(3)9-7-5-6-8-10-14(15)16;1-5(2,3)4/h5-12H,4H2,1-3H3,(H,15,16);1H3,(H,2,3,4)/b6-5+,9-7+,10-8+,13-11+; |
| InChIKey | UFTIOLVKBLDYFD-QWXNXTBDSA-N |
| XLogP | 3.24 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|