C25H29NO5 — CID 172868375
(3E,5S)-3-[(2E,4E,6E,8E,10R)-1-hydroxy-8,10-dimethyldodeca-2,4,6,8-tetraenylidene]-5-[(S)-hydroxy-(4-hydroxyphenyl)methyl]pyrrolidine-2,4-dione (PubChem CID 172868375) has the molecular formula C25H29NO5 and a molecular weight of 423.51 g/mol. Its IUPAC name is (3E,5S)-3-[(2E,4E,6E,8E,10R)-1-hydroxy-8,10-dimethyldodeca-2,4,6,8-tetraenylidene]-5-[(S)-hydroxy-(4-hydroxyphenyl)methyl]pyrrolidine-2,4-dione.
| Compound Name | (3E,5S)-3-[(2E,4E,6E,8E,10R)-1-hydroxy-8,10-dimethyldodeca-2,4,6,8-tetraenylidene]-5-[(S)-hydroxy-(4-hydroxyphenyl)methyl]pyrrolidine-2,4-dione |
|---|---|
| PubChem CID | 172868375 |
| Molecular Formula | C25H29NO5 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | (3E,5S)-3-[(2E,4E,6E,8E,10R)-1-hydroxy-8,10-dimethyldodeca-2,4,6,8-tetraenylidene]-5-[(S)-hydroxy-(4-hydroxyphenyl)methyl]pyrrolidine-2,4-dione |
| SMILES | CC[C@@H](C)/C=C(C)/C=C/C=C/C=C/C(O)=C1\C(=O)N[C@@H]([C@@H](O)c2ccc(O)cc2)C1=O |
| InChI | InChI=1S/C25H29NO5/c1-4-16(2)15-17(3)9-7-5-6-8-10-20(28)21-24(30)22(26-25(21)31)23(29)18-11-13-19(27)14-12-18/h5-16,22-23,27-29H,4H2,1-3H3,(H,26,31)/b6-5+,9-7+,10-8+,17-15+,21-20+/t16-,22+,23+/m1/s1 |
| InChIKey | ZYWUPCDHVYGPGI-PQAQWEFPSA-N |
| XLogP | 3.97 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|