C22H29NO5 — CID 177400513
5-[hydroxy-(4-hydroxyphenyl)methyl]-3-(1-hydroxy-2,4,6-trimethyloct-6-enylidene)pyrrolidine-2,4-dione (PubChem CID 177400513) has the molecular formula C22H29NO5 and a molecular weight of 387.48 g/mol. Its IUPAC name is 5-[hydroxy-(4-hydroxyphenyl)methyl]-3-(1-hydroxy-2,4,6-trimethyloct-6-enylidene)pyrrolidine-2,4-dione.
| Compound Name | 5-[hydroxy-(4-hydroxyphenyl)methyl]-3-(1-hydroxy-2,4,6-trimethyloct-6-enylidene)pyrrolidine-2,4-dione |
|---|---|
| PubChem CID | 177400513 |
| Molecular Formula | C22H29NO5 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | 5-[hydroxy-(4-hydroxyphenyl)methyl]-3-(1-hydroxy-2,4,6-trimethyloct-6-enylidene)pyrrolidine-2,4-dione |
| SMILES | CC=C(C)CC(C)CC(C)C(O)=C1C(=O)NC(C(O)c2ccc(O)cc2)C1=O |
| InChI | InChI=1S/C22H29NO5/c1-5-12(2)10-13(3)11-14(4)19(25)17-21(27)18(23-22(17)28)20(26)15-6-8-16(24)9-7-15/h5-9,13-14,18,20,24-26H,10-11H2,1-4H3,(H,23,28) |
| InChIKey | XMKADGQOSSRGKD-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|