C26H35N3O3 — CID 135476764
(3E,5S)-5-[(2R)-butan-2-yl]-3-(1-hydroxyethylidene)pyrrolidine-2,4-dione;N,N'-dibenzylethane-1,2-diamine (PubChem CID 135476764) has the molecular formula C26H35N3O3 and a molecular weight of 437.58 g/mol. Its IUPAC name is (3E,5S)-5-[(2R)-butan-2-yl]-3-(1-hydroxyethylidene)pyrrolidine-2,4-dione;N,N'-dibenzylethane-1,2-diamine.
| Compound Name | (3E,5S)-5-[(2R)-butan-2-yl]-3-(1-hydroxyethylidene)pyrrolidine-2,4-dione;N,N'-dibenzylethane-1,2-diamine |
|---|---|
| PubChem CID | 135476764 |
| Molecular Formula | C26H35N3O3 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.27 |
| IUPAC Name | (3E,5S)-5-[(2R)-butan-2-yl]-3-(1-hydroxyethylidene)pyrrolidine-2,4-dione;N,N'-dibenzylethane-1,2-diamine |
| SMILES | CC[C@@H](C)[C@@H]1NC(=O)/C(=C(\C)O)C1=O.c1ccc(CNCCNCc2ccccc2)cc1 |
| InChI | InChI=1S/C16H20N2.C10H15NO3/c1-3-7-15(8-4-1)13-17-11-12-18-14-16-9-5-2-6-10-16;1-4-5(2)8-9(13)7(6(3)12)10(14)11-8/h1-10,17-18H,11-14H2;5,8,12H,4H2,1-3H3,(H,11,14)/b;7-6+/t;5-,8+/m.1/s1 |
| InChIKey | RJXIEKYGQXKCJL-NODMZVMPSA-N |
| XLogP | 3.50 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|