C14H18N2O2 — CID 131938649
(3S,6S)-3-[(2S)-butan-2-yl]-6-phenylpiperazine-2,5-dione (PubChem CID 131938649) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is (3S,6S)-3-[(2S)-butan-2-yl]-6-phenylpiperazine-2,5-dione.
| Compound Name | (3S,6S)-3-[(2S)-butan-2-yl]-6-phenylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 131938649 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | (3S,6S)-3-[(2S)-butan-2-yl]-6-phenylpiperazine-2,5-dione |
| SMILES | CC[C@H](C)[C@@H]1NC(=O)[C@H](c2ccccc2)NC1=O |
| InChI | InChI=1S/C14H18N2O2/c1-3-9(2)11-13(17)16-12(14(18)15-11)10-7-5-4-6-8-10/h4-9,11-12H,3H2,1-2H3,(H,15,18)(H,16,17)/t9-,11-,12-/m0/s1 |
| InChIKey | AVNJOSAPWBBPES-DLOVCJGASA-N |
| XLogP | 1.39 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |