C36H66N6O6 — CID 146035611
(3S,6R,9S,12S,15R,18S)-3,6,12-tris[(2S)-butan-2-yl]-9,15,18-tris(2-methylpropyl)-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14,17-hexone (PubChem CID 146035611) has the molecular formula C36H66N6O6 and a molecular weight of 678.96 g/mol. Its IUPAC name is (3S,6R,9S,12S,15R,18S)-3,6,12-tris[(2S)-butan-2-yl]-9,15,18-tris(2-methylpropyl)-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14,17-hexone.
| Compound Name | (3S,6R,9S,12S,15R,18S)-3,6,12-tris[(2S)-butan-2-yl]-9,15,18-tris(2-methylpropyl)-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14,17-hexone |
|---|---|
| PubChem CID | 146035611 |
| Molecular Formula | C36H66N6O6 |
| Molecular Weight | 678.96 g/mol |
| Exact Mass | 678.50 |
| IUPAC Name | (3S,6R,9S,12S,15R,18S)-3,6,12-tris[(2S)-butan-2-yl]-9,15,18-tris(2-methylpropyl)-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14,17-hexone |
| SMILES | CC[C@H](C)[C@@H]1NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H]([C@@H](C)CC)NC(=O)[C@@H]([C@@H](C)CC)NC(=O)[C@H](CC(C)C)NC1=O |
| InChI | InChI=1S/C36H66N6O6/c1-13-22(10)28-34(46)39-27(18-21(8)9)33(45)41-30(24(12)15-3)36(48)42-29(23(11)14-2)35(47)38-25(16-19(4)5)31(43)37-26(17-20(6)7)32(44)40-28/h19-30H,13-18H2,1-12H3,(H,37,43)(H,38,47)(H,39,46)(H,40,44)(H,41,45)(H,42,48)/t22-,23-,24-,25-,26+,27-,28-,29-,30+/m0/s1 |
| InChIKey | FWRMXZJICBUHLB-VEDPMBGDSA-N |
| XLogP | 3.19 |
| TPSA | 174.60 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.96 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |