C18H32N4O6 — CID 139291189
3,9-di(butan-2-yl)-6,12-bis(hydroxymethyl)-1,4,7,10-tetrazacyclododecane-2,5,8,11-tetrone (PubChem CID 139291189) has the molecular formula C18H32N4O6 and a molecular weight of 400.48 g/mol. Its IUPAC name is 3,9-di(butan-2-yl)-6,12-bis(hydroxymethyl)-1,4,7,10-tetrazacyclododecane-2,5,8,11-tetrone.
| Compound Name | 3,9-di(butan-2-yl)-6,12-bis(hydroxymethyl)-1,4,7,10-tetrazacyclododecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 139291189 |
| Molecular Formula | C18H32N4O6 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | 3,9-di(butan-2-yl)-6,12-bis(hydroxymethyl)-1,4,7,10-tetrazacyclododecane-2,5,8,11-tetrone |
| SMILES | CCC(C)C1NC(=O)C(CO)NC(=O)C(C(C)CC)NC(=O)C(CO)NC1=O |
| InChI | InChI=1S/C18H32N4O6/c1-5-9(3)13-17(27)19-12(8-24)16(26)22-14(10(4)6-2)18(28)20-11(7-23)15(25)21-13/h9-14,23-24H,5-8H2,1-4H3,(H,19,27)(H,20,28)(H,21,25)(H,22,26) |
| InChIKey | ZWRGUQAGMGDEGO-UHFFFAOYSA-N |
| XLogP | -1.98 |
| TPSA | 156.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | -1.98 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |