C11H18O2 — CID 154133307
8-methyldeca-2,4-dienoic acid (PubChem CID 154133307) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is 8-methyldeca-2,4-dienoic acid.
| Compound Name | 8-methyldeca-2,4-dienoic acid |
|---|---|
| PubChem CID | 154133307 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | 8-methyldeca-2,4-dienoic acid |
| SMILES | CCC(C)CCC=CC=CC(=O)O |
| InChI | InChI=1S/C11H18O2/c1-3-10(2)8-6-4-5-7-9-11(12)13/h4-5,7,9-10H,3,6,8H2,1-2H3,(H,12,13) |
| InChIKey | ARNIESVKZFKNHY-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|