C8H17NO — CID 143024132
(E,4S)-2-methyl-4-(methylamino)hex-2-en-1-ol (PubChem CID 143024132) has the molecular formula C8H17NO and a molecular weight of 143.23 g/mol. Its IUPAC name is (E,4S)-2-methyl-4-(methylamino)hex-2-en-1-ol.
| Compound Name | (E,4S)-2-methyl-4-(methylamino)hex-2-en-1-ol |
|---|---|
| PubChem CID | 143024132 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | (E,4S)-2-methyl-4-(methylamino)hex-2-en-1-ol |
| SMILES | CC[C@@H](/C=C(\C)CO)NC |
| InChI | InChI=1S/C8H17NO/c1-4-8(9-3)5-7(2)6-10/h5,8-10H,4,6H2,1-3H3/b7-5+/t8-/m0/s1 |
| InChIKey | UYYJDCVUKMCWHF-IVGLGHLBSA-N |
| XLogP | 0.92 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|