C7H12ClNO — CID 142076424
(2E,4E)-5-chloro-2-methyl-5-(methylamino)penta-2,4-dien-1-ol (PubChem CID 142076424) has the molecular formula C7H12ClNO and a molecular weight of 161.63 g/mol. Its IUPAC name is (2E,4E)-5-chloro-2-methyl-5-(methylamino)penta-2,4-dien-1-ol.
| Compound Name | (2E,4E)-5-chloro-2-methyl-5-(methylamino)penta-2,4-dien-1-ol |
|---|---|
| PubChem CID | 142076424 |
| Molecular Formula | C7H12ClNO |
| Molecular Weight | 161.63 g/mol |
| Exact Mass | 161.06 |
| IUPAC Name | (2E,4E)-5-chloro-2-methyl-5-(methylamino)penta-2,4-dien-1-ol |
| SMILES | CN/C(Cl)=C\C=C(/C)CO |
| InChI | InChI=1S/C7H12ClNO/c1-6(5-10)3-4-7(8)9-2/h3-4,9-10H,5H2,1-2H3/b6-3+,7-4- |
| InChIKey | VDVUKBPASJJINE-JOVCIAKGSA-N |
| XLogP | 1.22 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.63 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|