C9H17N — CID 118534630
(2Z,4E)-N,5-dimethylhepta-2,4-dien-2-amine (PubChem CID 118534630) has the molecular formula C9H17N and a molecular weight of 139.24 g/mol. Its IUPAC name is (2Z,4E)-N,5-dimethylhepta-2,4-dien-2-amine.
| Compound Name | (2Z,4E)-N,5-dimethylhepta-2,4-dien-2-amine |
|---|---|
| PubChem CID | 118534630 |
| Molecular Formula | C9H17N |
| Molecular Weight | 139.24 g/mol |
| Exact Mass | 139.14 |
| IUPAC Name | (2Z,4E)-N,5-dimethylhepta-2,4-dien-2-amine |
| SMILES | CC/C(C)=C/C=C(/C)NC |
| InChI | InChI=1S/C9H17N/c1-5-8(2)6-7-9(3)10-4/h6-7,10H,5H2,1-4H3/b8-6+,9-7- |
| InChIKey | ZPKUWJUSLYYFID-FFELTBSMSA-N |
| XLogP | 2.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.24 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|