C11H20N2 — CID 137427614
(3E,5E)-N,6-dimethyl-2-(methylideneamino)octa-3,5-dien-3-amine (PubChem CID 137427614) has the molecular formula C11H20N2 and a molecular weight of 180.29 g/mol. Its IUPAC name is (3E,5E)-N,6-dimethyl-2-(methylideneamino)octa-3,5-dien-3-amine.
| Compound Name | (3E,5E)-N,6-dimethyl-2-(methylideneamino)octa-3,5-dien-3-amine |
|---|---|
| PubChem CID | 137427614 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | (3E,5E)-N,6-dimethyl-2-(methylideneamino)octa-3,5-dien-3-amine |
| SMILES | C=NC(C)/C(=C\C=C(/C)CC)NC |
| InChI | InChI=1S/C11H20N2/c1-6-9(2)7-8-11(13-5)10(3)12-4/h7-8,10,13H,4,6H2,1-3,5H3/b9-7+,11-8+ |
| InChIKey | JBTWOEYLZKGQBQ-BIZFVBGRSA-N |
| XLogP | 2.54 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|