C13H23N — CID 134409216
(2E,4E)-N-but-1-en-2-yl-2,5-dimethylhepta-2,4-dien-1-amine (PubChem CID 134409216) has the molecular formula C13H23N and a molecular weight of 193.33 g/mol. Its IUPAC name is (2E,4E)-N-but-1-en-2-yl-2,5-dimethylhepta-2,4-dien-1-amine.
| Compound Name | (2E,4E)-N-but-1-en-2-yl-2,5-dimethylhepta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 134409216 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | (2E,4E)-N-but-1-en-2-yl-2,5-dimethylhepta-2,4-dien-1-amine |
| SMILES | C=C(CC)NC/C(C)=C/C=C(\C)CC |
| InChI | InChI=1S/C13H23N/c1-6-11(3)8-9-12(4)10-14-13(5)7-2/h8-9,14H,5-7,10H2,1-4H3/b11-8+,12-9+ |
| InChIKey | DIEHPLWGCWGWLW-HZOWPXDZSA-N |
| XLogP | 3.80 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|