About (Z)-N,2-dimethylhex-3-en-3-amine
(Z)-N,2-dimethylhex-3-en-3-amine (PubChem CID 170980731) has the molecular formula C8H17N
and a molecular weight of 127.23 g/mol. Its IUPAC name is (Z)-N,2-dimethylhex-3-en-3-amine.
Molecular Properties
| Compound Name | (Z)-N,2-dimethylhex-3-en-3-amine |
| PubChem CID | 170980731 |
| Molecular Formula | C8H17N |
| Molecular Weight | 127.23 g/mol |
| Exact Mass | 127.14 |
| IUPAC Name | (Z)-N,2-dimethylhex-3-en-3-amine |
| SMILES | CC/C=C(\NC)C(C)C |
| InChI | InChI=1S/C8H17N/c1-5-6-8(9-4)7(2)3/h6-7,9H,5H2,1-4H3/b8-6- |
| InChIKey | VISJNIQNTJMVHZ-VURMDHGXSA-N |
| XLogP | 2.16 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.23 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (Z)-N,2-dimethylhex-3-en-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N,2-dimethylhex-3-en-3-amine?
The IUPAC name of (Z)-N,2-dimethylhex-3-en-3-amine (CID 170980731) is (Z)-N,2-dimethylhex-3-en-3-amine.
What is the SMILES notation for (Z)-N,2-dimethylhex-3-en-3-amine?
The canonical SMILES for (Z)-N,2-dimethylhex-3-en-3-amine is CC/C=C(\NC)C(C)C.
What is the InChIKey of (Z)-N,2-dimethylhex-3-en-3-amine?
The InChIKey is VISJNIQNTJMVHZ-VURMDHGXSA-N. The full InChI is InChI=1S/C8H17N/c1-5-6-8(9-4)7(2)3/h6-7,9H,5H2,1-4H3/b8-6-.
What are the key properties of (Z)-N,2-dimethylhex-3-en-3-amine?
(Z)-N,2-dimethylhex-3-en-3-amine has a molecular weight of 127.23 g/mol, XLogP of 2.16, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N,2-dimethylhex-3-en-3-amine is sourced from PubChem (CID 170980731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).