C11H21N — CID 138564764
(3E)-N,5-dimethylnona-3,8-dien-4-amine (PubChem CID 138564764) has the molecular formula C11H21N and a molecular weight of 167.30 g/mol. Its IUPAC name is (3E)-N,5-dimethylnona-3,8-dien-4-amine.
| Compound Name | (3E)-N,5-dimethylnona-3,8-dien-4-amine |
|---|---|
| PubChem CID | 138564764 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | (3E)-N,5-dimethylnona-3,8-dien-4-amine |
| SMILES | C=CCCC(C)/C(=C\CC)NC |
| InChI | InChI=1S/C11H21N/c1-5-7-9-10(3)11(12-4)8-6-2/h5,8,10,12H,1,6-7,9H2,2-4H3/b11-8+ |
| InChIKey | UZTDWWMGPPXHNW-DHZHZOJOSA-N |
| XLogP | 3.10 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|