C20H38N2 — CID 170275071
(E)-9-methyl-4-N-(4-methylpent-1-en-3-yl)-5-N-prop-1-en-2-yldec-3-ene-4,5-diamine (PubChem CID 170275071) has the molecular formula C20H38N2 and a molecular weight of 306.54 g/mol. Its IUPAC name is (E)-9-methyl-4-N-(4-methylpent-1-en-3-yl)-5-N-prop-1-en-2-yldec-3-ene-4,5-diamine.
| Compound Name | (E)-9-methyl-4-N-(4-methylpent-1-en-3-yl)-5-N-prop-1-en-2-yldec-3-ene-4,5-diamine |
|---|---|
| PubChem CID | 170275071 |
| Molecular Formula | C20H38N2 |
| Molecular Weight | 306.54 g/mol |
| Exact Mass | 306.30 |
| IUPAC Name | (E)-9-methyl-4-N-(4-methylpent-1-en-3-yl)-5-N-prop-1-en-2-yldec-3-ene-4,5-diamine |
| SMILES | C=CC(N/C(=C/CC)C(CCCC(C)C)NC(=C)C)C(C)C |
| InChI | InChI=1S/C20H38N2/c1-9-12-19(22-18(10-2)16(5)6)20(21-17(7)8)14-11-13-15(3)4/h10,12,15-16,18,20-22H,2,7,9,11,13-14H2,1,3-6,8H3/b19-12+ |
| InChIKey | ZQSQALCSWBPNQY-XDHOZWIPSA-N |
| XLogP | 5.40 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.54 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|